C31H24Cl2N6O7S — CID 136830313
5-[[4-[4-[[1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-hydroxybenzoic acid (PubChem CID 136830313) has the molecular formula C31H24Cl2N6O7S and a molecular weight of 695.54 g/mol. Its IUPAC name is 5-[[4-[4-[[1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[4-[[1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136830313 |
| Molecular Formula | C31H24Cl2N6O7S |
| Molecular Weight | 695.54 g/mol |
| Exact Mass | 694.08 |
| IUPAC Name | 5-[[4-[4-[[1-(2,5-dichloro-4-sulfophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]-3-methylphenyl]-2-methylphenyl]diazenyl]-2-hydroxybenzoic acid |
| SMILES | CC1=NN(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C(=O)C1/N=N/c1ccc(-c2ccc(/N=N/c3ccc(O)c(C(=O)O)c3)c(C)c2)cc1C |
| InChI | InChI=1S/C31H24Cl2N6O7S/c1-15-10-18(4-7-24(15)35-34-20-6-9-27(40)21(12-20)31(42)43)19-5-8-25(16(2)11-19)36-37-29-17(3)38-39(30(29)41)26-13-23(33)28(14-22(26)32)47(44,45)46/h4-14,29,40H,1-3H3,(H,42,43)(H,44,45,46)/b35-34+,37-36+ |
| InChIKey | UQKFYALCAHHSRM-XGMUGIETSA-N |
| XLogP | 8.22 |
| TPSA | 194.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.54 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|