C27H24N6Na2O6S — CID 170844942
CID 170844942 (PubChem CID 170844942) has the molecular formula C27H24N6Na2O6S and a molecular weight of 606.57 g/mol.
| Compound Name | CID 170844942 |
|---|---|
| PubChem CID | 170844942 |
| Molecular Formula | C27H24N6Na2O6S |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccc(/N=N/c3cc(S(=O)(=O)O)c(N)cc3N)c(C)c2)ccc1/N=N/c1ccc(O)c(C(=O)O)c1.[Na].[Na] |
| InChI | InChI=1S/C27H24N6O6S.2Na/c1-14-9-16(3-6-22(14)31-30-18-5-8-25(34)19(11-18)27(35)36)17-4-7-23(15(2)10-17)32-33-24-13-26(40(37,38)39)21(29)12-20(24)28;;/h3-13,34H,28-29H2,1-2H3,(H,35,36)(H,37,38,39);;/b31-30+,33-32+;; |
| InChIKey | SRQUNZLALCWYMI-MYYXEQMMSA-N |
| XLogP | 5.85 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|