C13H13N3O9S3 — CID 154320120
5-[(4-amino-2-methyl-5-sulfophenyl)diazenyl]benzene-1,3-disulfonic acid (PubChem CID 154320120) has the molecular formula C13H13N3O9S3 and a molecular weight of 451.46 g/mol. Its IUPAC name is 5-[(4-amino-2-methyl-5-sulfophenyl)diazenyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[(4-amino-2-methyl-5-sulfophenyl)diazenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 154320120 |
| Molecular Formula | C13H13N3O9S3 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 450.98 |
| IUPAC Name | 5-[(4-amino-2-methyl-5-sulfophenyl)diazenyl]benzene-1,3-disulfonic acid |
| SMILES | Cc1cc(N)c(S(=O)(=O)O)cc1/N=N/c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C13H13N3O9S3/c1-7-2-11(14)13(28(23,24)25)6-12(7)16-15-8-3-9(26(17,18)19)5-10(4-8)27(20,21)22/h2-6H,14H2,1H3,(H,17,18,19)(H,20,21,22)(H,23,24,25)/b16-15+ |
| InChIKey | SEQIERVCZUZUEY-FOCLMDBBSA-N |
| XLogP | 1.73 |
| TPSA | 213.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|