C13H14N4O6S2 — CID 154220394
2-amino-5-[(4-amino-2-methylphenyl)diazenyl]benzene-1,4-disulfonic acid (PubChem CID 154220394) has the molecular formula C13H14N4O6S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-amino-5-[(4-amino-2-methylphenyl)diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-amino-5-[(4-amino-2-methylphenyl)diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 154220394 |
| Molecular Formula | C13H14N4O6S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-amino-5-[(4-amino-2-methylphenyl)diazenyl]benzene-1,4-disulfonic acid |
| SMILES | Cc1cc(N)ccc1/N=N/c1cc(S(=O)(=O)O)c(N)cc1S(=O)(=O)O |
| InChI | InChI=1S/C13H14N4O6S2/c1-7-4-8(14)2-3-10(7)16-17-11-6-12(24(18,19)20)9(15)5-13(11)25(21,22)23/h2-6H,14-15H2,1H3,(H,18,19,20)(H,21,22,23)/b17-16+ |
| InChIKey | ADCACFFFBUQPQD-WUKNDPDISA-N |
| XLogP | 2.07 |
| TPSA | 185.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|