C13H14N4O2S — CID 175543778
4-[(4-amino-2-methylphenyl)diazenyl]benzenesulfonamide (PubChem CID 175543778) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 4-[(4-amino-2-methylphenyl)diazenyl]benzenesulfonamide.
| Compound Name | 4-[(4-amino-2-methylphenyl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175543778 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[(4-amino-2-methylphenyl)diazenyl]benzenesulfonamide |
| SMILES | Cc1cc(N)ccc1/N=N/c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-9-8-10(14)2-7-13(9)17-16-11-3-5-12(6-4-11)20(15,18)19/h2-8H,14H2,1H3,(H2,15,18,19)/b17-16+ |
| InChIKey | PFDXUBLXGRIDOS-WUKNDPDISA-N |
| XLogP | 2.64 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|