C14H13N5O3S — CID 135434982
4-[(5-amino-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide (PubChem CID 135434982) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is 4-[(5-amino-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide.
| Compound Name | 4-[(5-amino-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135434982 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-[(5-amino-2-hydroxy-1H-indol-3-yl)diazenyl]benzenesulfonamide |
| SMILES | Nc1ccc2[nH]c(O)c(/N=N/c3ccc(S(N)(=O)=O)cc3)c2c1 |
| InChI | InChI=1S/C14H13N5O3S/c15-8-1-6-12-11(7-8)13(14(20)17-12)19-18-9-2-4-10(5-3-9)23(16,21)22/h1-7,17,20H,15H2,(H2,16,21,22)/b19-18+ |
| InChIKey | NZYLQCXLZVYEQE-VHEBQXMUSA-N |
| XLogP | 2.52 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|