C31H27N11NaO9S3 — CID 173165002
CID 173165002 (PubChem CID 173165002) has the molecular formula C31H27N11NaO9S3 and a molecular weight of 816.82 g/mol.
| Compound Name | CID 173165002 |
|---|---|
| PubChem CID | 173165002 |
| Molecular Formula | C31H27N11NaO9S3 |
| Molecular Weight | 816.82 g/mol |
| Exact Mass | 816.11 |
| IUPAC Name | — |
| SMILES | CNS(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3ccc(-n4cncn4)cc23)cc1.NS(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3ccc(S(=O)(=O)O)cc23)cc1.[Na] |
| InChI | InChI=1S/C17H15N7O3S.C14H12N4O6S2.Na/c1-18-28(26,27)13-5-2-11(3-6-13)22-23-16-14-8-12(24-10-19-9-20-24)4-7-15(14)21-17(16)25;15-25(20,21)9-3-1-8(2-4-9)17-18-13-11-7-10(26(22,23)24)5-6-12(11)16-14(13)19;/h2-10,18,21,25H,1H3;1-7,16,19H,(H2,15,20,21)(H,22,23,24);/b23-22+;18-17+; |
| InChIKey | MNFXZLRMXUUCQM-PXHZSZSKSA-N |
| XLogP | 4.58 |
| TPSA | 312.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|