C15H16N8O4S2 — CID 171344571
4-[[3,5-diamino-1-(4-sulfamoylphenyl)pyrazol-4-yl]diazenyl]benzenesulfonamide (PubChem CID 171344571) has the molecular formula C15H16N8O4S2 and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-[[3,5-diamino-1-(4-sulfamoylphenyl)pyrazol-4-yl]diazenyl]benzenesulfonamide.
| Compound Name | 4-[[3,5-diamino-1-(4-sulfamoylphenyl)pyrazol-4-yl]diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171344571 |
| Molecular Formula | C15H16N8O4S2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 4-[[3,5-diamino-1-(4-sulfamoylphenyl)pyrazol-4-yl]diazenyl]benzenesulfonamide |
| SMILES | Nc1nn(-c2ccc(S(N)(=O)=O)cc2)c(N)c1/N=N/c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H16N8O4S2/c16-14-13(21-20-9-1-5-11(6-2-9)28(18,24)25)15(17)23(22-14)10-3-7-12(8-4-10)29(19,26)27/h1-8H,17H2,(H2,16,22)(H2,18,24,25)(H2,19,26,27)/b21-20+ |
| InChIKey | IBFIAYASPZANSM-QZQOTICOSA-N |
| XLogP | 0.75 |
| TPSA | 214.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|