C21H16ClN5O3S — CID 137086530
4-[[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid (PubChem CID 137086530) has the molecular formula C21H16ClN5O3S and a molecular weight of 453.91 g/mol. Its IUPAC name is 4-[[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 137086530 |
| Molecular Formula | C21H16ClN5O3S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 4-[[5-amino-3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(S(=O)(=O)O)cc2)c(-c2ccc(Cl)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H16ClN5O3S/c22-15-8-6-14(7-9-15)19-20(21(23)27(26-19)17-4-2-1-3-5-17)25-24-16-10-12-18(13-11-16)31(28,29)30/h1-13H,23H2,(H,28,29,30)/b25-24+ |
| InChIKey | QEHYCQIEWZKDCK-OCOZRVBESA-N |
| XLogP | 5.44 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|