C24H15Cl3N8O3S — CID 137086538
4-[[3-(4-chlorophenyl)-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid (PubChem CID 137086538) has the molecular formula C24H15Cl3N8O3S and a molecular weight of 601.86 g/mol. Its IUPAC name is 4-[[3-(4-chlorophenyl)-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[3-(4-chlorophenyl)-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 137086538 |
| Molecular Formula | C24H15Cl3N8O3S |
| Molecular Weight | 601.86 g/mol |
| Exact Mass | 600.01 |
| IUPAC Name | 4-[[3-(4-chlorophenyl)-5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-1-phenylpyrazol-4-yl]diazenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2c(-c3ccc(Cl)cc3)nn(-c3ccccc3)c2Nc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C24H15Cl3N8O3S/c25-15-8-6-14(7-9-15)19-20(33-32-16-10-12-18(13-11-16)39(36,37)38)21(28-24-30-22(26)29-23(27)31-24)35(34-19)17-4-2-1-3-5-17/h1-13H,(H,36,37,38)(H,28,29,30,31)/b33-32+ |
| InChIKey | FQZLCAJWOLICTN-ULIFNZDWSA-N |
| XLogP | 7.09 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.86 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|