C33H23ClN4O — CID 10907516
1-[4-[(4-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-2-naphthalen-2-ylethanone (PubChem CID 10907516) has the molecular formula C33H23ClN4O and a molecular weight of 527.03 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-2-naphthalen-2-ylethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-2-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 10907516 |
| Molecular Formula | C33H23ClN4O |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)diazenyl]-3,5-diphenylpyrazol-1-yl]-2-naphthalen-2-ylethanone |
| SMILES | O=C(Cc1ccc2ccccc2c1)n1nc(-c2ccccc2)c(/N=N/c2ccc(Cl)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C33H23ClN4O/c34-28-17-19-29(20-18-28)35-36-32-31(25-10-3-1-4-11-25)37-38(33(32)26-12-5-2-6-13-26)30(39)22-23-15-16-24-9-7-8-14-27(24)21-23/h1-21H,22H2/b36-35+ |
| InChIKey | RKYKFGXCJYHTOA-ULDVOPSXSA-N |
| XLogP | 9.32 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|