C22H14ClN5S — CID 14920703
(4-chlorophenyl)-(2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)diazene (PubChem CID 14920703) has the molecular formula C22H14ClN5S and a molecular weight of 415.91 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)diazene.
| Compound Name | (4-chlorophenyl)-(2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)diazene |
|---|---|
| PubChem CID | 14920703 |
| Molecular Formula | C22H14ClN5S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (4-chlorophenyl)-(2,6-diphenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)diazene |
| SMILES | Clc1ccc(/N=N/c2sc3nc(-c4ccccc4)nn3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H14ClN5S/c23-17-11-13-18(14-12-17)25-26-21-19(15-7-3-1-4-8-15)28-22(29-21)24-20(27-28)16-9-5-2-6-10-16/h1-14H/b26-25+ |
| InChIKey | CCELRZFGWOQJPH-OCEACIFDSA-N |
| XLogP | 7.19 |
| TPSA | 54.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|