C14H9ClN2S — CID 86217654
5-(4-chlorophenyl)-3-phenyl-1,2,4-thiadiazole (PubChem CID 86217654) has the molecular formula C14H9ClN2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-phenyl-1,2,4-thiadiazole.
| Compound Name | 5-(4-chlorophenyl)-3-phenyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 86217654 |
| Molecular Formula | C14H9ClN2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 5-(4-chlorophenyl)-3-phenyl-1,2,4-thiadiazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)ns2)cc1 |
| InChI | InChI=1S/C14H9ClN2S/c15-12-8-6-11(7-9-12)14-16-13(17-18-14)10-4-2-1-3-5-10/h1-9H |
| InChIKey | FFJNKZMIFJQLEG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |