C38H28N4S — CID 135398461
N,N-diphenyl-4-[5-[4-(N-phenylanilino)phenyl]-1,2,4-thiadiazol-3-yl]aniline (PubChem CID 135398461) has the molecular formula C38H28N4S and a molecular weight of 572.74 g/mol. Its IUPAC name is N,N-diphenyl-4-[5-[4-(N-phenylanilino)phenyl]-1,2,4-thiadiazol-3-yl]aniline.
| Compound Name | N,N-diphenyl-4-[5-[4-(N-phenylanilino)phenyl]-1,2,4-thiadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 135398461 |
| Molecular Formula | C38H28N4S |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | N,N-diphenyl-4-[5-[4-(N-phenylanilino)phenyl]-1,2,4-thiadiazol-3-yl]aniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc(-c3nsc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C38H28N4S/c1-5-13-31(14-6-1)41(32-15-7-2-8-16-32)35-25-21-29(22-26-35)37-39-38(43-40-37)30-23-27-36(28-24-30)42(33-17-9-3-10-18-33)34-19-11-4-12-20-34/h1-28H |
| InChIKey | RYHYOYAQOLQIOX-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |