C48H33N7 — CID 130353169
4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline (PubChem CID 130353169) has the molecular formula C48H33N7 and a molecular weight of 707.84 g/mol. Its IUPAC name is 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline.
| Compound Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 130353169 |
| Molecular Formula | C48H33N7 |
| Molecular Weight | 707.84 g/mol |
| Exact Mass | 707.28 |
| IUPAC Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-N-phenylaniline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N(c4ccccc4)c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C48H33N7/c1-6-16-34(17-7-1)43-49-44(35-18-8-2-9-19-35)52-47(51-43)38-26-30-41(31-27-38)55(40-24-14-5-15-25-40)42-32-28-39(29-33-42)48-53-45(36-20-10-3-11-21-36)50-46(54-48)37-22-12-4-13-23-37/h1-33H |
| InChIKey | HWSGZTFDSNZPRZ-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.84 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |