C70H49N3 — CID 58028667
N-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline (PubChem CID 58028667) has the molecular formula C70H49N3 and a molecular weight of 932.18 g/mol. Its IUPAC name is N-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline.
| Compound Name | N-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 58028667 |
| Molecular Formula | C70H49N3 |
| Molecular Weight | 932.18 g/mol |
| Exact Mass | 931.39 |
| IUPAC Name | N-[4-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]phenyl]phenyl]-4-phenyl-N-[4-(4-phenylphenyl)phenyl]aniline |
| SMILES | c1ccc(-c2ccc(-c3ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccc(-c6cc(-c7ccc(-c8ccccc8)cc7)nc(-c7ccc(-c8ccccc8)cc7)n6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C70H49N3/c1-5-13-50(14-6-1)54-21-23-57(24-22-54)60-39-45-66(46-40-60)73(65-43-37-59(38-44-65)53-19-11-4-12-20-53)67-47-41-61(42-48-67)58-27-33-63(34-28-58)69-49-68(62-31-25-55(26-32-62)51-15-7-2-8-16-51)71-70(72-69)64-35-29-56(30-36-64)52-17-9-3-10-18-52/h1-49H |
| InChIKey | GTCXBNRQOQIZIB-UHFFFAOYSA-N |
| XLogP | 18.95 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.18 |
| LogP ≤ 5 | 18.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |