C47H32N4 — CID 145009490
4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-N,N-diphenylaniline (PubChem CID 145009490) has the molecular formula C47H32N4 and a molecular weight of 652.80 g/mol. Its IUPAC name is 4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 145009490 |
| Molecular Formula | C47H32N4 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)phenanthren-2-yl]-N,N-diphenylaniline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(ccc5cc(-c6ccc(N(c7ccccc7)c7ccccc7)cc6)ccc54)c3)n2)cc1 |
| InChI | InChI=1S/C47H32N4/c1-5-13-34(14-6-1)45-48-46(35-15-7-2-8-16-35)50-47(49-45)39-26-30-44-38(32-39)22-21-37-31-36(25-29-43(37)44)33-23-27-42(28-24-33)51(40-17-9-3-10-18-40)41-19-11-4-12-20-41/h1-32H |
| InChIKey | JHACZDHAKPLOQF-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|