C66H43N7 — CID 164939243
N,N-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenanthren-2-ylnaphthalen-2-amine (PubChem CID 164939243) has the molecular formula C66H43N7 and a molecular weight of 934.12 g/mol. Its IUPAC name is N,N-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenanthren-2-ylnaphthalen-2-amine.
| Compound Name | N,N-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenanthren-2-ylnaphthalen-2-amine |
|---|---|
| PubChem CID | 164939243 |
| Molecular Formula | C66H43N7 |
| Molecular Weight | 934.12 g/mol |
| Exact Mass | 933.36 |
| IUPAC Name | N,N-bis[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenanthren-2-ylnaphthalen-2-amine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4ccc5cc(-c6ccc7c(ccc8ccccc87)c6)ccc5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C66H43N7/c1-5-16-45(17-6-1)61-67-62(46-18-7-2-8-19-46)70-65(69-61)49-29-35-56(36-30-49)73(57-37-31-50(32-38-57)66-71-63(47-20-9-3-10-21-47)68-64(72-66)48-22-11-4-12-23-48)58-39-33-52-41-51(26-27-54(52)43-58)53-34-40-60-55(42-53)28-25-44-15-13-14-24-59(44)60/h1-43H |
| InChIKey | VCOMHMZTSVQYQY-UHFFFAOYSA-N |
| XLogP | 16.66 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.12 |
| LogP ≤ 5 | 16.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|