C15H11BrN2S — CID 18731899
3-[4-(bromomethyl)phenyl]-5-phenyl-1,2,4-thiadiazole (PubChem CID 18731899) has the molecular formula C15H11BrN2S and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-[4-(bromomethyl)phenyl]-5-phenyl-1,2,4-thiadiazole.
| Compound Name | 3-[4-(bromomethyl)phenyl]-5-phenyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 18731899 |
| Molecular Formula | C15H11BrN2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 3-[4-(bromomethyl)phenyl]-5-phenyl-1,2,4-thiadiazole |
| SMILES | BrCc1ccc(-c2nsc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C15H11BrN2S/c16-10-11-6-8-12(9-7-11)14-17-15(19-18-14)13-4-2-1-3-5-13/h1-9H,10H2 |
| InChIKey | LEMBPHKLKHVPEK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|