C25H21Br — CID 174560327
1,1'-biphenyl;1-(bromomethyl)-4-phenylbenzene (PubChem CID 174560327) has the molecular formula C25H21Br and a molecular weight of 401.35 g/mol. Its IUPAC name is 1,1'-biphenyl;1-(bromomethyl)-4-phenylbenzene.
| Compound Name | 1,1'-biphenyl;1-(bromomethyl)-4-phenylbenzene |
|---|---|
| PubChem CID | 174560327 |
| Molecular Formula | C25H21Br |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1,1'-biphenyl;1-(bromomethyl)-4-phenylbenzene |
| SMILES | BrCc1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H11Br.C12H10/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-9H,10H2;1-10H |
| InChIKey | YDSYNJLAEIOPFG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|