C23H19FN2O2S — CID 144977351
ethane;2-fluoro-5-[3-(5-phenyl-1,2,4-thiadiazol-3-yl)phenyl]benzoic acid (PubChem CID 144977351) has the molecular formula C23H19FN2O2S and a molecular weight of 406.48 g/mol. Its IUPAC name is ethane;2-fluoro-5-[3-(5-phenyl-1,2,4-thiadiazol-3-yl)phenyl]benzoic acid.
| Compound Name | ethane;2-fluoro-5-[3-(5-phenyl-1,2,4-thiadiazol-3-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 144977351 |
| Molecular Formula | C23H19FN2O2S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | ethane;2-fluoro-5-[3-(5-phenyl-1,2,4-thiadiazol-3-yl)phenyl]benzoic acid |
| SMILES | CC.O=C(O)c1cc(-c2cccc(-c3nsc(-c4ccccc4)n3)c2)ccc1F |
| InChI | InChI=1S/C21H13FN2O2S.C2H6/c22-18-10-9-15(12-17(18)21(25)26)14-7-4-8-16(11-14)19-23-20(27-24-19)13-5-2-1-3-6-13;1-2/h1-12H,(H,25,26);1-2H3 |
| InChIKey | XANXYYWIVYCZDB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |