C25H16F4N2O2 — CID 118586364
2-fluoro-5-[3-[4-(3-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid (PubChem CID 118586364) has the molecular formula C25H16F4N2O2 and a molecular weight of 452.41 g/mol. Its IUPAC name is 2-fluoro-5-[3-[4-(3-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid.
| Compound Name | 2-fluoro-5-[3-[4-(3-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 118586364 |
| Molecular Formula | C25H16F4N2O2 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-fluoro-5-[3-[4-(3-methylphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid |
| SMILES | Cc1cccc(-c2cc(C(F)(F)F)nc(-c3cccc(-c4ccc(F)c(C(=O)O)c4)c3)n2)c1 |
| InChI | InChI=1S/C25H16F4N2O2/c1-14-4-2-6-17(10-14)21-13-22(25(27,28)29)31-23(30-21)18-7-3-5-15(11-18)16-8-9-20(26)19(12-16)24(32)33/h2-13H,1H3,(H,32,33) |
| InChIKey | FMNBZPVORNAZOJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |