C18H13F3N2 — CID 100981573
4-(4-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyrimidine (PubChem CID 100981573) has the molecular formula C18H13F3N2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(4-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 100981573 |
| Molecular Formula | C18H13F3N2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-(4-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H13F3N2/c1-12-7-9-13(10-8-12)15-11-16(18(19,20)21)23-17(22-15)14-5-3-2-4-6-14/h2-11H,1H3 |
| InChIKey | PFRKCHDGSFGPCX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |