C19H14F3N — CID 155775338
4-(3-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyridine (PubChem CID 155775338) has the molecular formula C19H14F3N and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-(3-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyridine.
| Compound Name | 4-(3-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 155775338 |
| Molecular Formula | C19H14F3N |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(3-methylphenyl)-2-phenyl-6-(trifluoromethyl)pyridine |
| SMILES | Cc1cccc(-c2cc(-c3ccccc3)nc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H14F3N/c1-13-6-5-9-15(10-13)16-11-17(14-7-3-2-4-8-14)23-18(12-16)19(20,21)22/h2-12H,1H3 |
| InChIKey | KWPSFFZDKAXCRC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |