C20H16F3N — CID 163288516
2,6-bis(3-methylphenyl)-4-(trifluoromethyl)pyridine (PubChem CID 163288516) has the molecular formula C20H16F3N and a molecular weight of 327.35 g/mol. Its IUPAC name is 2,6-bis(3-methylphenyl)-4-(trifluoromethyl)pyridine.
| Compound Name | 2,6-bis(3-methylphenyl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 163288516 |
| Molecular Formula | C20H16F3N |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2,6-bis(3-methylphenyl)-4-(trifluoromethyl)pyridine |
| SMILES | Cc1cccc(-c2cc(C(F)(F)F)cc(-c3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C20H16F3N/c1-13-5-3-7-15(9-13)18-11-17(20(21,22)23)12-19(24-18)16-8-4-6-14(2)10-16/h3-12H,1-2H3 |
| InChIKey | UXAXUVTYFOLHNL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |