C16H12F3N3 — CID 29088820
2-methyl-6-[3-(1H-pyrazol-5-yl)phenyl]-4-(trifluoromethyl)pyridine (PubChem CID 29088820) has the molecular formula C16H12F3N3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-methyl-6-[3-(1H-pyrazol-5-yl)phenyl]-4-(trifluoromethyl)pyridine.
| Compound Name | 2-methyl-6-[3-(1H-pyrazol-5-yl)phenyl]-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 29088820 |
| Molecular Formula | C16H12F3N3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-methyl-6-[3-(1H-pyrazol-5-yl)phenyl]-4-(trifluoromethyl)pyridine |
| SMILES | Cc1cc(C(F)(F)F)cc(-c2cccc(-c3ccn[nH]3)c2)n1 |
| InChI | InChI=1S/C16H12F3N3/c1-10-7-13(16(17,18)19)9-15(21-10)12-4-2-3-11(8-12)14-5-6-20-22-14/h2-9H,1H3,(H,20,22) |
| InChIKey | UNKVIBKBYDWQRK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |