C26H24N2 — CID 155790859
4-tert-butyl-2-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 155790859) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-tert-butyl-2-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 4-tert-butyl-2-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 155790859 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-tert-butyl-2-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3ccccc3)c2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H24N2/c1-26(2,3)24-18-23(27-25(28-24)20-13-8-5-9-14-20)22-16-10-15-21(17-22)19-11-6-4-7-12-19/h4-18H,1-3H3 |
| InChIKey | SXQOSYNWGVFQMC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |