C23H14ClF3N2O3S — CID 57468919
3-[3-[4-(4-chlorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzenesulfonic acid (PubChem CID 57468919) has the molecular formula C23H14ClF3N2O3S and a molecular weight of 490.89 g/mol. Its IUPAC name is 3-[3-[4-(4-chlorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzenesulfonic acid.
| Compound Name | 3-[3-[4-(4-chlorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 57468919 |
| Molecular Formula | C23H14ClF3N2O3S |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 3-[3-[4-(4-chlorophenyl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(-c2cccc(-c3nc(-c4ccc(Cl)cc4)cc(C(F)(F)F)n3)c2)c1 |
| InChI | InChI=1S/C23H14ClF3N2O3S/c24-18-9-7-14(8-10-18)20-13-21(23(25,26)27)29-22(28-20)17-5-1-3-15(11-17)16-4-2-6-19(12-16)33(30,31)32/h1-13H,(H,30,31,32) |
| InChIKey | UZXYLJOTHLSZKV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|