C24H13F7N2 — CID 151250350
4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(3-phenylphenyl)-6-(trifluoromethyl)pyrimidine (PubChem CID 151250350) has the molecular formula C24H13F7N2 and a molecular weight of 462.37 g/mol. Its IUPAC name is 4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(3-phenylphenyl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(3-phenylphenyl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 151250350 |
| Molecular Formula | C24H13F7N2 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-(3-phenylphenyl)-6-(trifluoromethyl)pyrimidine |
| SMILES | Fc1cc(-c2cc(C(F)(F)F)nc(-c3cccc(-c4ccccc4)c3)n2)ccc1C(F)(F)F |
| InChI | InChI=1S/C24H13F7N2/c25-19-12-16(9-10-18(19)23(26,27)28)20-13-21(24(29,30)31)33-22(32-20)17-8-4-7-15(11-17)14-5-2-1-3-6-14/h1-13H |
| InChIKey | NSERNKAIMUHGAJ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |