C26H20F3NO3S — CID 57469016
3-[3-[6-ethyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonic acid (PubChem CID 57469016) has the molecular formula C26H20F3NO3S and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[3-[6-ethyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonic acid.
| Compound Name | 3-[3-[6-ethyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 57469016 |
| Molecular Formula | C26H20F3NO3S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-[3-[6-ethyl-4-[4-(trifluoromethyl)phenyl]-2-pyridinyl]phenyl]benzenesulfonic acid |
| SMILES | CCc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(-c3cccc(S(=O)(=O)O)c3)c2)n1 |
| InChI | InChI=1S/C26H20F3NO3S/c1-2-23-14-21(17-9-11-22(12-10-17)26(27,28)29)16-25(30-23)20-7-3-5-18(13-20)19-6-4-8-24(15-19)34(31,32)33/h3-16H,2H2,1H3,(H,31,32,33) |
| InChIKey | FTRVONXZKPGOJZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|