C13H9F3O4S — CID 69045913
[3-[4-(trifluoromethyl)phenyl]phenyl] hydrogen sulfate (PubChem CID 69045913) has the molecular formula C13H9F3O4S and a molecular weight of 318.27 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]phenyl] hydrogen sulfate.
| Compound Name | [3-[4-(trifluoromethyl)phenyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 69045913 |
| Molecular Formula | C13H9F3O4S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]phenyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C13H9F3O4S/c14-13(15,16)11-6-4-9(5-7-11)10-2-1-3-12(8-10)20-21(17,18)19/h1-8H,(H,17,18,19) |
| InChIKey | CNLYAYYUCIYIHH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|