C22H15F6NO2 — CID 150657328
[3-[4-(trifluoromethyl)phenyl]-5-[6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl acetate (PubChem CID 150657328) has the molecular formula C22H15F6NO2 and a molecular weight of 439.36 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]-5-[6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl acetate.
| Compound Name | [3-[4-(trifluoromethyl)phenyl]-5-[6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 150657328 |
| Molecular Formula | C22H15F6NO2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]-5-[6-(trifluoromethyl)-2-pyridinyl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C22H15F6NO2/c1-13(30)31-12-14-9-16(15-5-7-18(8-6-15)21(23,24)25)11-17(10-14)19-3-2-4-20(29-19)22(26,27)28/h2-11H,12H2,1H3 |
| InChIKey | JDCZHDGYLAHDOU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |