C18H15F3N4O2 — CID 152940282
ethyl 5-[4-[4-(trifluoromethyl)phenyl]anilino]-2H-triazole-4-carboxylate (PubChem CID 152940282) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is ethyl 5-[4-[4-(trifluoromethyl)phenyl]anilino]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-[4-(trifluoromethyl)phenyl]anilino]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 152940282 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | ethyl 5-[4-[4-(trifluoromethyl)phenyl]anilino]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1Nc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H15F3N4O2/c1-2-27-17(26)15-16(24-25-23-15)22-14-9-5-12(6-10-14)11-3-7-13(8-4-11)18(19,20)21/h3-10H,2H2,1H3,(H2,22,23,24,25) |
| InChIKey | UMRCOEQDZASGPX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |