C13H12F3N3O3 — CID 169399340
ethyl 5-[3-methoxy-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169399340) has the molecular formula C13H12F3N3O3 and a molecular weight of 315.25 g/mol. Its IUPAC name is ethyl 5-[3-methoxy-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-methoxy-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169399340 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | ethyl 5-[3-methoxy-5-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(OC)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3N3O3/c1-3-22-12(20)11-10(17-19-18-11)7-4-8(13(14,15)16)6-9(5-7)21-2/h4-6H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | SMMVVKDFQSUBQK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |