C13H14FN3O4 — CID 169401502
ethyl 5-(2-fluoro-4,6-dimethoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169401502) has the molecular formula C13H14FN3O4 and a molecular weight of 295.27 g/mol. Its IUPAC name is ethyl 5-(2-fluoro-4,6-dimethoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(2-fluoro-4,6-dimethoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401502 |
| Molecular Formula | C13H14FN3O4 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | ethyl 5-(2-fluoro-4,6-dimethoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1c(F)cc(OC)cc1OC |
| InChI | InChI=1S/C13H14FN3O4/c1-4-21-13(18)12-11(15-17-16-12)10-8(14)5-7(19-2)6-9(10)20-3/h5-6H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | PYEVXXHROSXUJB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |