C13H11F4N3O2 — CID 169400620
ethyl 5-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169400620) has the molecular formula C13H11F4N3O2 and a molecular weight of 317.24 g/mol. Its IUPAC name is ethyl 5-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400620 |
| Molecular Formula | C13H11F4N3O2 |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | ethyl 5-[2-fluoro-5-methyl-4-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(C)c(C(F)(F)F)cc1F |
| InChI | InChI=1S/C13H11F4N3O2/c1-3-22-12(21)11-10(18-20-19-11)7-4-6(2)8(5-9(7)14)13(15,16)17/h4-5H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | DUJOSGXRJUBNQC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |