C12H9BrF3N3O3 — CID 169401910
ethyl 5-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate (PubChem CID 169401910) has the molecular formula C12H9BrF3N3O3 and a molecular weight of 380.12 g/mol. Its IUPAC name is ethyl 5-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169401910 |
| Molecular Formula | C12H9BrF3N3O3 |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | ethyl 5-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1c(C(F)(F)F)ccc(Br)c1O |
| InChI | InChI=1S/C12H9BrF3N3O3/c1-2-22-11(21)9-8(17-19-18-9)7-5(12(14,15)16)3-4-6(13)10(7)20/h3-4,20H,2H2,1H3,(H,17,18,19) |
| InChIKey | JEALLMPUHGQJHC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |