C14H12F3NO3S — CID 91898851
ethyl 4-hydroxy-2-[4-(trifluoromethyl)anilino]thiophene-3-carboxylate (PubChem CID 91898851) has the molecular formula C14H12F3NO3S and a molecular weight of 331.32 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-[4-(trifluoromethyl)anilino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-[4-(trifluoromethyl)anilino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91898851 |
| Molecular Formula | C14H12F3NO3S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | ethyl 4-hydroxy-2-[4-(trifluoromethyl)anilino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)csc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F3NO3S/c1-2-21-13(20)11-10(19)7-22-12(11)18-9-5-3-8(4-6-9)14(15,16)17/h3-7,18-19H,2H2,1H3 |
| InChIKey | SXQPDHVASUORMK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|