C13H11Cl2NO3S — CID 91898845
ethyl 2-(3,5-dichloroanilino)-4-hydroxythiophene-3-carboxylate (PubChem CID 91898845) has the molecular formula C13H11Cl2NO3S and a molecular weight of 332.21 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloroanilino)-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl 2-(3,5-dichloroanilino)-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 91898845 |
| Molecular Formula | C13H11Cl2NO3S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | ethyl 2-(3,5-dichloroanilino)-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)csc1Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3S/c1-2-19-13(18)11-10(17)6-20-12(11)16-9-4-7(14)3-8(15)5-9/h3-6,16-17H,2H2,1H3 |
| InChIKey | RMVNQHOQMYBQJN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|