C10H12ClNO3S — CID 2777457
ethyl 2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 2777457) has the molecular formula C10H12ClNO3S and a molecular weight of 261.73 g/mol. Its IUPAC name is ethyl 2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2777457 |
| Molecular Formula | C10H12ClNO3S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | ethyl 2-[(2-chloroacetyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)csc1NC(=O)CCl |
| InChI | InChI=1S/C10H12ClNO3S/c1-3-15-10(14)8-6(2)5-16-9(8)12-7(13)4-11/h5H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | FNHRABDDUBUKTK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|