C15H15NO4S2 — CID 135471561
ethyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]-4-methylthiophene-3-carboxylate (PubChem CID 135471561) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 135471561 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | ethyl 2-[(2,4-dihydroxybenzenecarbothioyl)amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)csc1NC(=S)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H15NO4S2/c1-3-20-15(19)12-8(2)7-22-14(12)16-13(21)10-5-4-9(17)6-11(10)18/h4-7,17-18H,3H2,1-2H3,(H,16,21) |
| InChIKey | ICQYZJAVWMMZLQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|