C17H18N2O5S — CID 175896622
methyl 2-[(3-ethoxycarbonylphenyl)carbamoylamino]-4-methylthiophene-3-carboxylate (PubChem CID 175896622) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 2-[(3-ethoxycarbonylphenyl)carbamoylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-ethoxycarbonylphenyl)carbamoylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 175896622 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[(3-ethoxycarbonylphenyl)carbamoylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cccc(NC(=O)Nc2scc(C)c2C(=O)OC)c1 |
| InChI | InChI=1S/C17H18N2O5S/c1-4-24-15(20)11-6-5-7-12(8-11)18-17(22)19-14-13(16(21)23-3)10(2)9-25-14/h5-9H,4H2,1-3H3,(H2,18,19,22) |
| InChIKey | UKFUGUJKSCPAND-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |