C14H13Cl2N3O2 — CID 17121379
ethyl 2-(3,5-dichloroanilino)-4-methylpyrimidine-5-carboxylate (PubChem CID 17121379) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is ethyl 2-(3,5-dichloroanilino)-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3,5-dichloroanilino)-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 17121379 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | ethyl 2-(3,5-dichloroanilino)-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cc(Cl)cc(Cl)c2)nc1C |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-3-21-13(20)12-7-17-14(18-8(12)2)19-11-5-9(15)4-10(16)6-11/h4-7H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | ZZBJIQQTLMORNG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |