C15H18N2O2S — CID 79375573
ethyl 5-(4-ethylanilino)-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 79375573) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is ethyl 5-(4-ethylanilino)-3-methyl-1,2-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(4-ethylanilino)-3-methyl-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 79375573 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | ethyl 5-(4-ethylanilino)-3-methyl-1,2-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nsc1Nc1ccc(CC)cc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-4-11-6-8-12(9-7-11)16-14-13(10(3)17-20-14)15(18)19-5-2/h6-9,16H,4-5H2,1-3H3 |
| InChIKey | LSAFVRJCEYSQTL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |