C13H11Cl3N2O2S — CID 79370989
ethyl 3-methyl-5-(2,4,5-trichloroanilino)-1,2-thiazole-4-carboxylate (PubChem CID 79370989) has the molecular formula C13H11Cl3N2O2S and a molecular weight of 365.67 g/mol. Its IUPAC name is ethyl 3-methyl-5-(2,4,5-trichloroanilino)-1,2-thiazole-4-carboxylate.
| Compound Name | ethyl 3-methyl-5-(2,4,5-trichloroanilino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 79370989 |
| Molecular Formula | C13H11Cl3N2O2S |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | ethyl 3-methyl-5-(2,4,5-trichloroanilino)-1,2-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nsc1Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2O2S/c1-3-20-13(19)11-6(2)18-21-12(11)17-10-5-8(15)7(14)4-9(10)16/h4-5,17H,3H2,1-2H3 |
| InChIKey | ZCBAIHHPJRNDDO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|