C22H13F3N2O3 — CID 118586574
3-[3-[4-(furan-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid (PubChem CID 118586574) has the molecular formula C22H13F3N2O3 and a molecular weight of 410.35 g/mol. Its IUPAC name is 3-[3-[4-(furan-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid.
| Compound Name | 3-[3-[4-(furan-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 118586574 |
| Molecular Formula | C22H13F3N2O3 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-[3-[4-(furan-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]phenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(-c3nc(-c4ccoc4)cc(C(F)(F)F)n3)c2)c1 |
| InChI | InChI=1S/C22H13F3N2O3/c23-22(24,25)19-11-18(17-7-8-30-12-17)26-20(27-19)15-5-1-3-13(9-15)14-4-2-6-16(10-14)21(28)29/h1-12H,(H,28,29) |
| InChIKey | YJRRMHMRFVMDKM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |