C10H7NO3 — CID 91623804
2-(furan-3-yl)pyridine-4-carboxylic acid (PubChem CID 91623804) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-(furan-3-yl)pyridine-4-carboxylic acid.
| Compound Name | 2-(furan-3-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 91623804 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-(furan-3-yl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2ccoc2)c1 |
| InChI | InChI=1S/C10H7NO3/c12-10(13)7-1-3-11-9(5-7)8-2-4-14-6-8/h1-6H,(H,12,13) |
| InChIKey | VMEZENYWAAFWDI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |