C13H8N2O6 — CID 58788780
6-(4-carboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid (PubChem CID 58788780) has the molecular formula C13H8N2O6 and a molecular weight of 288.22 g/mol. Its IUPAC name is 6-(4-carboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid.
| Compound Name | 6-(4-carboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 58788780 |
| Molecular Formula | C13H8N2O6 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 6-(4-carboxy-2-pyridinyl)pyridine-3,4-dicarboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2cc(C(=O)O)c(C(=O)O)cn2)c1 |
| InChI | InChI=1S/C13H8N2O6/c16-11(17)6-1-2-14-9(3-6)10-4-7(12(18)19)8(5-15-10)13(20)21/h1-5H,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | AJYXHCSNKJDGNZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |