About 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid
2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid (PubChem CID 58252537) has the molecular formula C9H7N3O3
and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid.
Analyze 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid?
The IUPAC name of 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid (CID 58252537) is 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid?
The canonical SMILES for 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid is Cc1noc(-c2cc(C(=O)O)ccn2)n1.
What is the InChIKey of 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid?
The InChIKey is TYASDKUXGAEFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3/c1-5-11-8(15-12-5)7-4-6(9(13)14)2-3-10-7/h2-4H,1H3,(H,13,14).
What are the key properties of 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid?
2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid has a molecular weight of 205.17 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2,4-oxadiazol-5-yl)pyridine-4-carboxylic acid is sourced from PubChem (CID 58252537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).