C23H18N4O2 — CID 135645739
2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]phenyl]acetic acid (PubChem CID 135645739) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 135645739 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[4-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(/N=N/c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C23H18N4O2/c28-20(29)15-16-11-13-19(14-12-16)26-27-23-24-21(17-7-3-1-4-8-17)22(25-23)18-9-5-2-6-10-18/h1-14H,15H2,(H,24,25)(H,28,29)/b27-26+ |
| InChIKey | GAQIBDKSPHCKCG-CYYJNZCTSA-N |
| XLogP | 5.79 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|